C24H26O7 — CID 177491538
ethyl 3-[(2S,3S)-3-[(6-methoxy-1-oxo-4-phenylmethoxy-3H-2-benzofuran-5-yl)methyl]oxiran-2-yl]propanoate (PubChem CID 177491538) has the molecular formula C24H26O7 and a molecular weight of 426.47 g/mol. Its IUPAC name is ethyl 3-[(2S,3S)-3-[(6-methoxy-1-oxo-4-phenylmethoxy-3H-2-benzofuran-5-yl)methyl]oxiran-2-yl]propanoate.
| Compound Name | ethyl 3-[(2S,3S)-3-[(6-methoxy-1-oxo-4-phenylmethoxy-3H-2-benzofuran-5-yl)methyl]oxiran-2-yl]propanoate |
|---|---|
| PubChem CID | 177491538 |
| Molecular Formula | C24H26O7 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | ethyl 3-[(2S,3S)-3-[(6-methoxy-1-oxo-4-phenylmethoxy-3H-2-benzofuran-5-yl)methyl]oxiran-2-yl]propanoate |
| SMILES | CCOC(=O)CC[C@@H]1O[C@H]1Cc1c(OC)cc2c(c1OCc1ccccc1)COC2=O |
| InChI | InChI=1S/C24H26O7/c1-3-28-22(25)10-9-19-21(31-19)12-17-20(27-2)11-16-18(14-30-24(16)26)23(17)29-13-15-7-5-4-6-8-15/h4-8,11,19,21H,3,9-10,12-14H2,1-2H3/t19-,21-/m0/s1 |
| InChIKey | AOAZMKHHYIVPHR-FPOVZHCZSA-N |
| XLogP | 3.60 |
| TPSA | 83.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|