C62H56O12 — CID 56927572
(11S,12S)-11,12-dimethoxy-3,4,5,18,19,20-hexakis(phenylmethoxy)-9,14-dioxatricyclo[14.4.0.02,7]icosa-1(20),2,4,6,16,18-hexaene-8,15-dione (PubChem CID 56927572) has the molecular formula C62H56O12 and a molecular weight of 993.12 g/mol. Its IUPAC name is (11S,12S)-11,12-dimethoxy-3,4,5,18,19,20-hexakis(phenylmethoxy)-9,14-dioxatricyclo[14.4.0.02,7]icosa-1(20),2,4,6,16,18-hexaene-8,15-dione.
| Compound Name | (11S,12S)-11,12-dimethoxy-3,4,5,18,19,20-hexakis(phenylmethoxy)-9,14-dioxatricyclo[14.4.0.02,7]icosa-1(20),2,4,6,16,18-hexaene-8,15-dione |
|---|---|
| PubChem CID | 56927572 |
| Molecular Formula | C62H56O12 |
| Molecular Weight | 993.12 g/mol |
| Exact Mass | 992.38 |
| IUPAC Name | (11S,12S)-11,12-dimethoxy-3,4,5,18,19,20-hexakis(phenylmethoxy)-9,14-dioxatricyclo[14.4.0.02,7]icosa-1(20),2,4,6,16,18-hexaene-8,15-dione |
| SMILES | CO[C@H]1COC(=O)c2cc(OCc3ccccc3)c(OCc3ccccc3)c(OCc3ccccc3)c2-c2c(cc(OCc3ccccc3)c(OCc3ccccc3)c2OCc2ccccc2)C(=O)OC[C@@H]1OC |
| InChI | InChI=1S/C62H56O12/c1-65-53-41-73-61(63)49-33-51(67-35-43-21-9-3-10-22-43)57(69-37-45-25-13-5-14-26-45)59(71-39-47-29-17-7-18-30-47)55(49)56-50(62(64)74-42-54(53)66-2)34-52(68-36-44-23-11-4-12-24-44)58(70-38-46-27-15-6-16-28-46)60(56)72-40-48-31-19-8-20-32-48/h3-34,53-54H,35-42H2,1-2H3/t53-,54-/m0/s1 |
| InChIKey | BXAZFIFBRHSWFF-PJYGOTMFSA-N |
| XLogP | 12.18 |
| TPSA | 126.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 993.12 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |