C43H44O14 — CID 73058409
3,5,17,19-tetrakis(methoxymethoxy)-4-(naphthalen-2-ylmethoxy)-18-phenylmethoxy-9,13-dioxatricyclo[13.4.0.02,7]nonadeca-1(19),2,4,6,15,17-hexaene-8,14-dione (PubChem CID 73058409) has the molecular formula C43H44O14 and a molecular weight of 784.81 g/mol. Its IUPAC name is 3,5,17,19-tetrakis(methoxymethoxy)-4-(naphthalen-2-ylmethoxy)-18-phenylmethoxy-9,13-dioxatricyclo[13.4.0.02,7]nonadeca-1(19),2,4,6,15,17-hexaene-8,14-dione.
| Compound Name | 3,5,17,19-tetrakis(methoxymethoxy)-4-(naphthalen-2-ylmethoxy)-18-phenylmethoxy-9,13-dioxatricyclo[13.4.0.02,7]nonadeca-1(19),2,4,6,15,17-hexaene-8,14-dione |
|---|---|
| PubChem CID | 73058409 |
| Molecular Formula | C43H44O14 |
| Molecular Weight | 784.81 g/mol |
| Exact Mass | 784.27 |
| IUPAC Name | 3,5,17,19-tetrakis(methoxymethoxy)-4-(naphthalen-2-ylmethoxy)-18-phenylmethoxy-9,13-dioxatricyclo[13.4.0.02,7]nonadeca-1(19),2,4,6,15,17-hexaene-8,14-dione |
| SMILES | COCOc1cc2c(c(OCOC)c1OCc1ccccc1)-c1c(cc(OCOC)c(OCc3ccc4ccccc4c3)c1OCOC)C(=O)OCCCOC2=O |
| InChI | InChI=1S/C43H44O14/c1-46-24-54-34-20-32-36(40(56-26-48-3)38(34)52-22-28-11-6-5-7-12-28)37-33(43(45)51-18-10-17-50-42(32)44)21-35(55-25-47-2)39(41(37)57-27-49-4)53-23-29-15-16-30-13-8-9-14-31(30)19-29/h5-9,11-16,19-21H,10,17-18,22-27H2,1-4H3 |
| InChIKey | LUFGJVQKKARHJN-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 144.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.81 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|