C49H44O14 — CID 149116127
(10R,13R)-3,5,21,23-tetrahydroxy-13-methoxy-4,11,12,22-tetrakis(phenylmethoxy)-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(23),2,4,6,19,21-hexaene-8,18-dione (PubChem CID 149116127) has the molecular formula C49H44O14 and a molecular weight of 856.88 g/mol. Its IUPAC name is (10R,13R)-3,5,21,23-tetrahydroxy-13-methoxy-4,11,12,22-tetrakis(phenylmethoxy)-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(23),2,4,6,19,21-hexaene-8,18-dione.
| Compound Name | (10R,13R)-3,5,21,23-tetrahydroxy-13-methoxy-4,11,12,22-tetrakis(phenylmethoxy)-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(23),2,4,6,19,21-hexaene-8,18-dione |
|---|---|
| PubChem CID | 149116127 |
| Molecular Formula | C49H44O14 |
| Molecular Weight | 856.88 g/mol |
| Exact Mass | 856.27 |
| IUPAC Name | (10R,13R)-3,5,21,23-tetrahydroxy-13-methoxy-4,11,12,22-tetrakis(phenylmethoxy)-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(23),2,4,6,19,21-hexaene-8,18-dione |
| SMILES | CO[C@@H]1OC2COC(=O)c3cc(O)c(OCc4ccccc4)c(O)c3-c3c(cc(O)c(OCc4ccccc4)c3O)C(=O)O[C@H]2C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C49H44O14/c1-56-49-46(60-27-32-20-12-5-13-21-32)45(59-26-31-18-10-4-11-19-31)44-37(62-49)28-61-47(54)33-22-35(50)42(57-24-29-14-6-2-7-15-29)40(52)38(33)39-34(48(55)63-44)23-36(51)43(41(39)53)58-25-30-16-8-3-9-17-30/h2-23,37,44-46,49-53H,24-28H2,1H3/t37?,44-,45?,46?,49-/m1/s1 |
| InChIKey | QYKGACOBVGTDGS-NXKFEMRSSA-N |
| XLogP | 7.57 |
| TPSA | 188.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.88 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |