C13H16O6S — CID 11616399
(4aR,6S,7S,7aR)-6-methoxy-7-phenylmethoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxathiine 2-oxide (PubChem CID 11616399) has the molecular formula C13H16O6S and a molecular weight of 300.33 g/mol. Its IUPAC name is (4aR,6S,7S,7aR)-6-methoxy-7-phenylmethoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxathiine 2-oxide.
| Compound Name | (4aR,6S,7S,7aR)-6-methoxy-7-phenylmethoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxathiine 2-oxide |
|---|---|
| PubChem CID | 11616399 |
| Molecular Formula | C13H16O6S |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | (4aR,6S,7S,7aR)-6-methoxy-7-phenylmethoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxathiine 2-oxide |
| SMILES | CO[C@H]1O[C@@H]2COS(=O)O[C@H]2[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C13H16O6S/c1-15-13-12(16-7-9-5-3-2-4-6-9)11-10(18-13)8-17-20(14)19-11/h2-6,10-13H,7-8H2,1H3/t10-,11-,12+,13+,20?/m1/s1 |
| InChIKey | MQVIPRKIJYLVAG-ALFDZHFWSA-N |
| XLogP | 0.94 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |