C14H19NO3 — CID 14262086
(2R,3R,3aR,6aS)-2-methoxy-3-phenylmethoxy-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrole (PubChem CID 14262086) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is (2R,3R,3aR,6aS)-2-methoxy-3-phenylmethoxy-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrole.
| Compound Name | (2R,3R,3aR,6aS)-2-methoxy-3-phenylmethoxy-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrole |
|---|---|
| PubChem CID | 14262086 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | (2R,3R,3aR,6aS)-2-methoxy-3-phenylmethoxy-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrole |
| SMILES | CO[C@@H]1O[C@H]2CCN[C@H]2[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C14H19NO3/c1-16-14-13(12-11(18-14)7-8-15-12)17-9-10-5-3-2-4-6-10/h2-6,11-15H,7-9H2,1H3/t11-,12+,13+,14+/m0/s1 |
| InChIKey | PTWMNKNVQMGAEN-REWJHTLYSA-N |
| XLogP | 1.30 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |