C31H38O16 — CID 162936962
[3,4-diacetyloxy-5-[[3,4,5-triacetyloxy-6-(4-ethenylphenoxy)oxan-2-yl]methoxy]oxolan-3-yl]methyl acetate (PubChem CID 162936962) has the molecular formula C31H38O16 and a molecular weight of 666.63 g/mol. Its IUPAC name is [3,4-diacetyloxy-5-[[3,4,5-triacetyloxy-6-(4-ethenylphenoxy)oxan-2-yl]methoxy]oxolan-3-yl]methyl acetate.
| Compound Name | [3,4-diacetyloxy-5-[[3,4,5-triacetyloxy-6-(4-ethenylphenoxy)oxan-2-yl]methoxy]oxolan-3-yl]methyl acetate |
|---|---|
| PubChem CID | 162936962 |
| Molecular Formula | C31H38O16 |
| Molecular Weight | 666.63 g/mol |
| Exact Mass | 666.22 |
| IUPAC Name | [3,4-diacetyloxy-5-[[3,4,5-triacetyloxy-6-(4-ethenylphenoxy)oxan-2-yl]methoxy]oxolan-3-yl]methyl acetate |
| SMILES | C=Cc1ccc(OC2OC(COC3OCC(COC(C)=O)(OC(C)=O)C3OC(C)=O)C(OC(C)=O)C(OC(C)=O)C2OC(C)=O)cc1 |
| InChI | InChI=1S/C31H38O16/c1-8-22-9-11-23(12-10-22)45-29-27(43-19(5)35)26(42-18(4)34)25(41-17(3)33)24(46-29)13-38-30-28(44-20(6)36)31(15-40-30,47-21(7)37)14-39-16(2)32/h8-12,24-30H,1,13-15H2,2-7H3 |
| InChIKey | LHFHPDSKRBQSIO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 194.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.63 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|