C25H26N2O13 — CID 56674677
[3,4,5-triacetyloxy-6-[4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]oxan-2-yl]methyl acetate (PubChem CID 56674677) has the molecular formula C25H26N2O13 and a molecular weight of 562.48 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 56674677 |
| Molecular Formula | C25H26N2O13 |
| Molecular Weight | 562.48 g/mol |
| Exact Mass | 562.14 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(Oc2ccc(C=C3C(=O)NC(=O)NC3=O)cc2)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C25H26N2O13/c1-11(28)35-10-18-19(36-12(2)29)20(37-13(3)30)21(38-14(4)31)24(40-18)39-16-7-5-15(6-8-16)9-17-22(32)26-25(34)27-23(17)33/h5-9,18-21,24H,10H2,1-4H3,(H2,26,27,32,33,34) |
| InChIKey | OUIKYOJILBXVGO-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 198.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.48 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|