C25H26N2O14 — CID 45270075
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-hydroxy-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]oxan-2-yl]methyl acetate (PubChem CID 45270075) has the molecular formula C25H26N2O14 and a molecular weight of 578.48 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-hydroxy-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-hydroxy-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 45270075 |
| Molecular Formula | C25H26N2O14 |
| Molecular Weight | 578.48 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-hydroxy-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2ccc(C=C3C(=O)NC(=O)NC3=O)cc2O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H26N2O14/c1-10(28)36-9-18-19(37-11(2)29)20(38-12(3)30)21(39-13(4)31)24(41-18)40-17-6-5-14(8-16(17)32)7-15-22(33)26-25(35)27-23(15)34/h5-8,18-21,24,32H,9H2,1-4H3,(H2,26,27,33,34,35)/t18-,19-,20+,21-,24-/m1/s1 |
| InChIKey | FOMHFKHKGXZTRL-XQWURTRYSA-N |
| XLogP | -0.40 |
| TPSA | 219.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.48 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|