C29H50O3 — CID 162937146
17-(6,6-dimethyloxan-2-yl)-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,12-diol (PubChem CID 162937146) has the molecular formula C29H50O3 and a molecular weight of 446.72 g/mol. Its IUPAC name is 17-(6,6-dimethyloxan-2-yl)-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,12-diol.
| Compound Name | 17-(6,6-dimethyloxan-2-yl)-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,12-diol |
|---|---|
| PubChem CID | 162937146 |
| Molecular Formula | C29H50O3 |
| Molecular Weight | 446.72 g/mol |
| Exact Mass | 446.38 |
| IUPAC Name | 17-(6,6-dimethyloxan-2-yl)-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,12-diol |
| SMILES | CC1(C)CCCC(C2CCC3(C)C2C(O)CC2C4(C)CCC(O)C(C)(C)C4CCC23C)O1 |
| InChI | InChI=1S/C29H50O3/c1-25(2)13-8-9-20(32-25)18-10-15-29(7)24(18)19(30)17-22-27(5)14-12-23(31)26(3,4)21(27)11-16-28(22,29)6/h18-24,30-31H,8-17H2,1-7H3 |
| InChIKey | SYFJYASKXNAXKC-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.72 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |