C16H26O8 — CID 162938662
(5R)-5-[(2R)-2-hydroxy-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl]-2-methylcyclohex-2-en-1-one (PubChem CID 162938662) has the molecular formula C16H26O8 and a molecular weight of 346.38 g/mol. Its IUPAC name is (5R)-5-[(2R)-2-hydroxy-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl]-2-methylcyclohex-2-en-1-one.
| Compound Name | (5R)-5-[(2R)-2-hydroxy-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl]-2-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 162938662 |
| Molecular Formula | C16H26O8 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (5R)-5-[(2R)-2-hydroxy-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl]-2-methylcyclohex-2-en-1-one |
| SMILES | CC1=CC[C@@H]([C@@](C)(O)CO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)CC1=O |
| InChI | InChI=1S/C16H26O8/c1-8-3-4-9(5-10(8)18)16(2,22)7-23-15-14(21)13(20)12(19)11(6-17)24-15/h3,9,11-15,17,19-22H,4-7H2,1-2H3/t9-,11-,12-,13+,14-,15-,16+/m1/s1 |
| InChIKey | VHKVJYPHKNZCFD-QWIQOESASA-N |
| XLogP | -1.52 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |