C12H20N2O2S2 — CID 162939171
3-methylsulfanyl-N-[4-(3-methylsulfanylprop-2-enoylamino)butyl]prop-2-enamide (PubChem CID 162939171) has the molecular formula C12H20N2O2S2 and a molecular weight of 288.44 g/mol. Its IUPAC name is 3-methylsulfanyl-N-[4-(3-methylsulfanylprop-2-enoylamino)butyl]prop-2-enamide.
| Compound Name | 3-methylsulfanyl-N-[4-(3-methylsulfanylprop-2-enoylamino)butyl]prop-2-enamide |
|---|---|
| PubChem CID | 162939171 |
| Molecular Formula | C12H20N2O2S2 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 3-methylsulfanyl-N-[4-(3-methylsulfanylprop-2-enoylamino)butyl]prop-2-enamide |
| SMILES | CSC=CC(=O)NCCCCNC(=O)C=CSC |
| InChI | InChI=1S/C12H20N2O2S2/c1-17-9-5-11(15)13-7-3-4-8-14-12(16)6-10-18-2/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | SOZZFXSEKXBXFS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|