C26H34O14 — CID 162939255
[(2S,3S,4R,5R,6R)-5-acetyloxy-3-hydroxy-2-methyl-6-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-methoxy-4-(3-oxoprop-1-enyl)phenoxy]oxan-2-yl]methoxy]oxan-4-yl] acetate (PubChem CID 162939255) has the molecular formula C26H34O14 and a molecular weight of 570.54 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6R)-5-acetyloxy-3-hydroxy-2-methyl-6-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-methoxy-4-(3-oxoprop-1-enyl)phenoxy]oxan-2-yl]methoxy]oxan-4-yl] acetate.
| Compound Name | [(2S,3S,4R,5R,6R)-5-acetyloxy-3-hydroxy-2-methyl-6-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-methoxy-4-(3-oxoprop-1-enyl)phenoxy]oxan-2-yl]methoxy]oxan-4-yl] acetate |
|---|---|
| PubChem CID | 162939255 |
| Molecular Formula | C26H34O14 |
| Molecular Weight | 570.54 g/mol |
| Exact Mass | 570.19 |
| IUPAC Name | [(2S,3S,4R,5R,6R)-5-acetyloxy-3-hydroxy-2-methyl-6-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-methoxy-4-(3-oxoprop-1-enyl)phenoxy]oxan-2-yl]methoxy]oxan-4-yl] acetate |
| SMILES | COc1cc(C=CC=O)ccc1O[C@@H]1O[C@H](CO[C@@H]2O[C@@H](C)[C@H](O)[C@@H](OC(C)=O)[C@H]2OC(C)=O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C26H34O14/c1-12-19(30)23(37-13(2)28)24(38-14(3)29)26(36-12)35-11-18-20(31)21(32)22(33)25(40-18)39-16-8-7-15(6-5-9-27)10-17(16)34-4/h5-10,12,18-26,30-33H,11H2,1-4H3/t12-,18+,19-,20+,21-,22+,23+,24+,25+,26+/m0/s1 |
| InChIKey | KGRNBCOVONOWLX-KGQOKOFWSA-N |
| XLogP | -0.92 |
| TPSA | 196.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.54 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|