C16H18O5 — CID 162939847
5,7-dimethoxy-8-(3-methylbut-2-enoxy)chromen-4-one (PubChem CID 162939847) has the molecular formula C16H18O5 and a molecular weight of 290.32 g/mol. Its IUPAC name is 5,7-dimethoxy-8-(3-methylbut-2-enoxy)chromen-4-one.
| Compound Name | 5,7-dimethoxy-8-(3-methylbut-2-enoxy)chromen-4-one |
|---|---|
| PubChem CID | 162939847 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 5,7-dimethoxy-8-(3-methylbut-2-enoxy)chromen-4-one |
| SMILES | COc1cc(OC)c2c(=O)ccoc2c1OCC=C(C)C |
| InChI | InChI=1S/C16H18O5/c1-10(2)5-7-20-15-13(19-4)9-12(18-3)14-11(17)6-8-21-16(14)15/h5-6,8-9H,7H2,1-4H3 |
| InChIKey | UDXPSNKJOKMSBL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|