C21H26N4O5 — CID 162942227
2-[(2S,3R,4S,5S)-3,4-dihydroxy-5-[[(4-methylphenyl)carbamoylamino]methyl]oxolan-2-yl]-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 162942227) has the molecular formula C21H26N4O5 and a molecular weight of 414.46 g/mol. Its IUPAC name is 2-[(2S,3R,4S,5S)-3,4-dihydroxy-5-[[(4-methylphenyl)carbamoylamino]methyl]oxolan-2-yl]-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | 2-[(2S,3R,4S,5S)-3,4-dihydroxy-5-[[(4-methylphenyl)carbamoylamino]methyl]oxolan-2-yl]-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 162942227 |
| Molecular Formula | C21H26N4O5 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 2-[(2S,3R,4S,5S)-3,4-dihydroxy-5-[[(4-methylphenyl)carbamoylamino]methyl]oxolan-2-yl]-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | Cc1ccc(NC(=O)NC[C@@H]2O[C@@H](CC(=O)NCc3cccnc3)[C@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C21H26N4O5/c1-13-4-6-15(7-5-13)25-21(29)24-12-17-20(28)19(27)16(30-17)9-18(26)23-11-14-3-2-8-22-10-14/h2-8,10,16-17,19-20,27-28H,9,11-12H2,1H3,(H,23,26)(H2,24,25,29)/t16-,17-,19-,20+/m0/s1 |
| InChIKey | MYOSFFWHZGAFBV-QGZVKYPTSA-N |
| XLogP | 0.71 |
| TPSA | 132.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |