C31H48O10 — CID 162942557
[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 15-(3-hydroxy-3-methylbutanoyl)oxy-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate (PubChem CID 162942557) has the molecular formula C31H48O10 and a molecular weight of 580.72 g/mol. Its IUPAC name is [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 15-(3-hydroxy-3-methylbutanoyl)oxy-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate.
| Compound Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 15-(3-hydroxy-3-methylbutanoyl)oxy-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
|---|---|
| PubChem CID | 162942557 |
| Molecular Formula | C31H48O10 |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.32 |
| IUPAC Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 15-(3-hydroxy-3-methylbutanoyl)oxy-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
| SMILES | C=C1C2CCC3C4(C)CCCC(C)(C(=O)OC5OC(CO)C(O)C(O)C5O)C4CCC3(C2)C1OC(=O)CC(C)(C)O |
| InChI | InChI=1S/C31H48O10/c1-16-17-7-8-20-29(4)10-6-11-30(5,27(37)41-26-24(36)23(35)22(34)18(15-32)39-26)19(29)9-12-31(20,13-17)25(16)40-21(33)14-28(2,3)38/h17-20,22-26,32,34-36,38H,1,6-15H2,2-5H3 |
| InChIKey | XSXPSVMPYIAGOS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|