C50H72O2 — CID 162942955
2-[2-[2,2,4-trimethyl-3-[3,7,12,16-tetramethyl-18-[2,6,6-trimethyl-5-(3-methylbut-2-enyl)cyclohexen-1-yl]octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohex-3-en-1-yl]ethylidene]propane-1,3-diol (PubChem CID 162942955) has the molecular formula C50H72O2 and a molecular weight of 705.12 g/mol. Its IUPAC name is 2-[2-[2,2,4-trimethyl-3-[3,7,12,16-tetramethyl-18-[2,6,6-trimethyl-5-(3-methylbut-2-enyl)cyclohexen-1-yl]octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohex-3-en-1-yl]ethylidene]propane-1,3-diol.
| Compound Name | 2-[2-[2,2,4-trimethyl-3-[3,7,12,16-tetramethyl-18-[2,6,6-trimethyl-5-(3-methylbut-2-enyl)cyclohexen-1-yl]octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohex-3-en-1-yl]ethylidene]propane-1,3-diol |
|---|---|
| PubChem CID | 162942955 |
| Molecular Formula | C50H72O2 |
| Molecular Weight | 705.12 g/mol |
| Exact Mass | 704.55 |
| IUPAC Name | 2-[2-[2,2,4-trimethyl-3-[3,7,12,16-tetramethyl-18-[2,6,6-trimethyl-5-(3-methylbut-2-enyl)cyclohexen-1-yl]octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohex-3-en-1-yl]ethylidene]propane-1,3-diol |
| SMILES | CC(C)=CCC1CCC(C)=C(C=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC2=C(C)CCC(CC=C(CO)CO)C2(C)C)C1(C)C |
| InChI | InChI=1S/C50H72O2/c1-37(2)23-29-45-30-26-42(7)47(49(45,9)10)33-24-40(5)21-15-19-38(3)17-13-14-18-39(4)20-16-22-41(6)25-34-48-43(8)27-31-46(50(48,11)12)32-28-44(35-51)36-52/h13-25,28,33-34,45-46,51-52H,26-27,29-32,35-36H2,1-12H3 |
| InChIKey | SRLTWXXKEIVCFJ-UHFFFAOYSA-N |
| XLogP | 13.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.12 |
| LogP ≤ 5 | 13.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|