C36H48O10 — CID 162943830
[3,10,11-trihydroxy-9-(hydroxymethyl)-13,15-dimethyl-4-prop-1-en-2-yl-8,24,26,27-tetraoxaheptacyclo[12.10.1.14,23.15,23.01,6.07,9.011,25]heptacosan-12-yl] benzoate (PubChem CID 162943830) has the molecular formula C36H48O10 and a molecular weight of 640.77 g/mol. Its IUPAC name is [3,10,11-trihydroxy-9-(hydroxymethyl)-13,15-dimethyl-4-prop-1-en-2-yl-8,24,26,27-tetraoxaheptacyclo[12.10.1.14,23.15,23.01,6.07,9.011,25]heptacosan-12-yl] benzoate.
| Compound Name | [3,10,11-trihydroxy-9-(hydroxymethyl)-13,15-dimethyl-4-prop-1-en-2-yl-8,24,26,27-tetraoxaheptacyclo[12.10.1.14,23.15,23.01,6.07,9.011,25]heptacosan-12-yl] benzoate |
|---|---|
| PubChem CID | 162943830 |
| Molecular Formula | C36H48O10 |
| Molecular Weight | 640.77 g/mol |
| Exact Mass | 640.32 |
| IUPAC Name | [3,10,11-trihydroxy-9-(hydroxymethyl)-13,15-dimethyl-4-prop-1-en-2-yl-8,24,26,27-tetraoxaheptacyclo[12.10.1.14,23.15,23.01,6.07,9.011,25]heptacosan-12-yl] benzoate |
| SMILES | C=C(C)C12OC34CCCCCCCC(C)C5C(C)C(OC(=O)c6ccccc6)C6(O)C(O)C7(CO)OC7C(C1O3)C(CC2O)(O4)C56 |
| InChI | InChI=1S/C36H48O10/c1-19(2)36-23(38)17-32-25-28-33(18-37,43-28)31(40)35(41)26(32)24(21(4)27(35)42-30(39)22-14-10-8-11-15-22)20(3)13-9-6-5-7-12-16-34(45-32,46-36)44-29(25)36/h8,10-11,14-15,20-21,23-29,31,37-38,40-41H,1,5-7,9,12-13,16-18H2,2-4H3 |
| InChIKey | IYWZOYLNAGNLSX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 147.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.77 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|