C39H50O8 — CID 163094602
22-(hydroxymethyl)-16,18,28-trimethyl-19-(1-phenylethenoxy)-7-prop-1-en-2-yl-2,6,23,27-tetraoxanonacyclo[15.8.1.11,3.14,8.03,8.04,7.05,25.020,26.022,24]octacosane-20,21-diol (PubChem CID 163094602) has the molecular formula C39H50O8 and a molecular weight of 646.82 g/mol. Its IUPAC name is 22-(hydroxymethyl)-16,18,28-trimethyl-19-(1-phenylethenoxy)-7-prop-1-en-2-yl-2,6,23,27-tetraoxanonacyclo[15.8.1.11,3.14,8.03,8.04,7.05,25.020,26.022,24]octacosane-20,21-diol.
| Compound Name | 22-(hydroxymethyl)-16,18,28-trimethyl-19-(1-phenylethenoxy)-7-prop-1-en-2-yl-2,6,23,27-tetraoxanonacyclo[15.8.1.11,3.14,8.03,8.04,7.05,25.020,26.022,24]octacosane-20,21-diol |
|---|---|
| PubChem CID | 163094602 |
| Molecular Formula | C39H50O8 |
| Molecular Weight | 646.82 g/mol |
| Exact Mass | 646.35 |
| IUPAC Name | 22-(hydroxymethyl)-16,18,28-trimethyl-19-(1-phenylethenoxy)-7-prop-1-en-2-yl-2,6,23,27-tetraoxanonacyclo[15.8.1.11,3.14,8.03,8.04,7.05,25.020,26.022,24]octacosane-20,21-diol |
| SMILES | C=C(OC1C(C)C2C(C)CCCCCCCC34OC56C(OC35C(=C)C)C3C5OC5(CO)C(O)C1(O)C2C31OC46C1C)c1ccccc1 |
| InChI | InChI=1S/C39H50O8/c1-20(2)37-34-18-14-9-7-8-11-15-21(3)26-22(4)29(43-23(5)25-16-12-10-13-17-25)35(42)28(26)36-24(6)38(34,47-36)39(37,46-34)31(45-37)27(36)30-33(19-40,44-30)32(35)41/h10,12-13,16-17,21-22,24,26-32,40-42H,1,5,7-9,11,14-15,18-19H2,2-4,6H3 |
| InChIKey | YWWRNHONLWHJHH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.82 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|