C24H34O7 — CID 162944785
methyl 4-acetyloxy-3-oxo-8-(1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl)-2,7-dioxabicyclo[3.2.1]octane-6-carboxylate (PubChem CID 162944785) has the molecular formula C24H34O7 and a molecular weight of 434.53 g/mol. Its IUPAC name is methyl 4-acetyloxy-3-oxo-8-(1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl)-2,7-dioxabicyclo[3.2.1]octane-6-carboxylate.
| Compound Name | methyl 4-acetyloxy-3-oxo-8-(1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl)-2,7-dioxabicyclo[3.2.1]octane-6-carboxylate |
|---|---|
| PubChem CID | 162944785 |
| Molecular Formula | C24H34O7 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | methyl 4-acetyloxy-3-oxo-8-(1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl)-2,7-dioxabicyclo[3.2.1]octane-6-carboxylate |
| SMILES | C=C1CCCC(C)(C)C2CCC(C)(C3C4OC(=O)C(OC(C)=O)C3C(C(=O)OC)O4)C12 |
| InChI | InChI=1S/C24H34O7/c1-12-8-7-10-23(3,4)14-9-11-24(5,16(12)14)17-15-18(20(26)28-6)30-22(17)31-21(27)19(15)29-13(2)25/h14-19,22H,1,7-11H2,2-6H3 |
| InChIKey | OSCWWLKPYDISKR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|