C15H20O2 — CID 162945435
(3S,8E,10R)-pentadeca-1,8-dien-4,6-diyne-3,10-diol (PubChem CID 162945435) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (3S,8E,10R)-pentadeca-1,8-dien-4,6-diyne-3,10-diol.
| Compound Name | (3S,8E,10R)-pentadeca-1,8-dien-4,6-diyne-3,10-diol |
|---|---|
| PubChem CID | 162945435 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (3S,8E,10R)-pentadeca-1,8-dien-4,6-diyne-3,10-diol |
| SMILES | C=C[C@H](O)C#CC#C/C=C/[C@H](O)CCCCC |
| InChI | InChI=1S/C15H20O2/c1-3-5-8-12-15(17)13-10-7-6-9-11-14(16)4-2/h4,10,13-17H,2-3,5,8,12H2,1H3/b13-10+/t14-,15+/m0/s1 |
| InChIKey | DXXGLHOAKNZRRB-XEZFYOOLSA-N |
| XLogP | 2.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|