C22H24O9 — CID 162946674
2-(7-hydroxy-2,4-dimethoxyphenanthren-3-yl)oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 162946674) has the molecular formula C22H24O9 and a molecular weight of 432.43 g/mol. Its IUPAC name is 2-(7-hydroxy-2,4-dimethoxyphenanthren-3-yl)oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-(7-hydroxy-2,4-dimethoxyphenanthren-3-yl)oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 162946674 |
| Molecular Formula | C22H24O9 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 2-(7-hydroxy-2,4-dimethoxyphenanthren-3-yl)oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | COc1cc2ccc3cc(O)ccc3c2c(OC)c1OC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C22H24O9/c1-28-14-8-11-4-3-10-7-12(24)5-6-13(10)16(11)21(29-2)20(14)31-22-19(27)18(26)17(25)15(9-23)30-22/h3-8,15,17-19,22-27H,9H2,1-2H3 |
| InChIKey | JFLVGRGATGWONA-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|