C29H36O14 — CID 163104612
2-methyl-6-[[3,4,5-trihydroxy-6-(6-hydroxy-1,5,7-trimethoxyphenanthren-2-yl)oxyoxan-2-yl]methoxy]oxane-3,4,5-triol (PubChem CID 163104612) has the molecular formula C29H36O14 and a molecular weight of 608.59 g/mol. Its IUPAC name is 2-methyl-6-[[3,4,5-trihydroxy-6-(6-hydroxy-1,5,7-trimethoxyphenanthren-2-yl)oxyoxan-2-yl]methoxy]oxane-3,4,5-triol.
| Compound Name | 2-methyl-6-[[3,4,5-trihydroxy-6-(6-hydroxy-1,5,7-trimethoxyphenanthren-2-yl)oxyoxan-2-yl]methoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 163104612 |
| Molecular Formula | C29H36O14 |
| Molecular Weight | 608.59 g/mol |
| Exact Mass | 608.21 |
| IUPAC Name | 2-methyl-6-[[3,4,5-trihydroxy-6-(6-hydroxy-1,5,7-trimethoxyphenanthren-2-yl)oxyoxan-2-yl]methoxy]oxane-3,4,5-triol |
| SMILES | COc1cc2ccc3c(OC)c(OC4OC(COC5OC(C)C(O)C(O)C5O)C(O)C(O)C4O)ccc3c2c(OC)c1O |
| InChI | InChI=1S/C29H36O14/c1-11-19(30)22(33)24(35)28(41-11)40-10-17-20(31)23(34)25(36)29(43-17)42-15-8-7-13-14(26(15)38-3)6-5-12-9-16(37-2)21(32)27(39-4)18(12)13/h5-9,11,17,19-20,22-25,28-36H,10H2,1-4H3 |
| InChIKey | JRGKTSLTCMKOKE-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 206.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.59 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|