C21H32N2 — CID 162948521
(1R,2S,5S,6R,9R,12S,13R,16S)-6,13-dimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icosa-7,18-dien-16-amine (PubChem CID 162948521) has the molecular formula C21H32N2 and a molecular weight of 312.50 g/mol. Its IUPAC name is (1R,2S,5S,6R,9R,12S,13R,16S)-6,13-dimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icosa-7,18-dien-16-amine.
| Compound Name | (1R,2S,5S,6R,9R,12S,13R,16S)-6,13-dimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icosa-7,18-dien-16-amine |
|---|---|
| PubChem CID | 162948521 |
| Molecular Formula | C21H32N2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.26 |
| IUPAC Name | (1R,2S,5S,6R,9R,12S,13R,16S)-6,13-dimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icosa-7,18-dien-16-amine |
| SMILES | C[C@H]1N=C[C@]23CC[C@H]4[C@@H](CC=C5C[C@@H](N)CC[C@@]54C)[C@@H]2CC[C@H]13 |
| InChI | InChI=1S/C21H32N2/c1-13-17-5-6-19-16-4-3-14-11-15(22)7-9-20(14,2)18(16)8-10-21(17,19)12-23-13/h3,12-13,15-19H,4-11,22H2,1-2H3/t13-,15+,16-,17-,18+,19+,20+,21+/m1/s1 |
| InChIKey | ALQAUMHHCJMVID-SRYLZWHESA-N |
| XLogP | 4.35 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|