C22H30O2 — CID 162951163
2-[[(6R)-2,6-dimethyl-6-(4-methylpenta-1,3-dienyl)cyclohexen-1-yl]methyl]-4-methoxyphenol (PubChem CID 162951163) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is 2-[[(6R)-2,6-dimethyl-6-(4-methylpenta-1,3-dienyl)cyclohexen-1-yl]methyl]-4-methoxyphenol.
| Compound Name | 2-[[(6R)-2,6-dimethyl-6-(4-methylpenta-1,3-dienyl)cyclohexen-1-yl]methyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 162951163 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 2-[[(6R)-2,6-dimethyl-6-(4-methylpenta-1,3-dienyl)cyclohexen-1-yl]methyl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c(CC2=C(C)CCC[C@]2(C)C=CC=C(C)C)c1 |
| InChI | InChI=1S/C22H30O2/c1-16(2)8-6-12-22(4)13-7-9-17(3)20(22)15-18-14-19(24-5)10-11-21(18)23/h6,8,10-12,14,23H,7,9,13,15H2,1-5H3/t22-/m0/s1 |
| InChIKey | NCAUXCIBEDUXEZ-QFIPXVFZSA-N |
| XLogP | 5.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|