C15H22O3 — CID 162951664
5,7',7'a-trimethylspiro[2,6-dioxabicyclo[3.1.0]hexane-4,2'-3,3a,4,5,6,7-hexahydro-1H-indene]-3-one (PubChem CID 162951664) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 5,7',7'a-trimethylspiro[2,6-dioxabicyclo[3.1.0]hexane-4,2'-3,3a,4,5,6,7-hexahydro-1H-indene]-3-one.
| Compound Name | 5,7',7'a-trimethylspiro[2,6-dioxabicyclo[3.1.0]hexane-4,2'-3,3a,4,5,6,7-hexahydro-1H-indene]-3-one |
|---|---|
| PubChem CID | 162951664 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 5,7',7'a-trimethylspiro[2,6-dioxabicyclo[3.1.0]hexane-4,2'-3,3a,4,5,6,7-hexahydro-1H-indene]-3-one |
| SMILES | CC1CCCC2CC3(CC12C)C(=O)OC1OC13C |
| InChI | InChI=1S/C15H22O3/c1-9-5-4-6-10-7-15(8-13(9,10)2)11(16)17-12-14(15,3)18-12/h9-10,12H,4-8H2,1-3H3 |
| InChIKey | ZWAZKYCZTVFNCI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|