C22H32O14 — CID 162955593
methyl 4-hydroxy-1,4,5-trimethyl-3,7-dioxo-12-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,5,8,8a,12,12a-hexahydropyrano[3,4-g][1,5]dioxecine-9-carboxylate (PubChem CID 162955593) has the molecular formula C22H32O14 and a molecular weight of 520.48 g/mol. Its IUPAC name is methyl 4-hydroxy-1,4,5-trimethyl-3,7-dioxo-12-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,5,8,8a,12,12a-hexahydropyrano[3,4-g][1,5]dioxecine-9-carboxylate.
| Compound Name | methyl 4-hydroxy-1,4,5-trimethyl-3,7-dioxo-12-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,5,8,8a,12,12a-hexahydropyrano[3,4-g][1,5]dioxecine-9-carboxylate |
|---|---|
| PubChem CID | 162955593 |
| Molecular Formula | C22H32O14 |
| Molecular Weight | 520.48 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | methyl 4-hydroxy-1,4,5-trimethyl-3,7-dioxo-12-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,5,8,8a,12,12a-hexahydropyrano[3,4-g][1,5]dioxecine-9-carboxylate |
| SMILES | COC(=O)C1=COC(OC2OC(CO)C(O)C(O)C2O)C2C(C)OC(=O)C(C)(O)C(C)OC(=O)CC12 |
| InChI | InChI=1S/C22H32O14/c1-8-14-10(5-13(24)34-9(2)22(3,30)21(29)33-8)11(18(28)31-4)7-32-19(14)36-20-17(27)16(26)15(25)12(6-23)35-20/h7-10,12,14-17,19-20,23,25-27,30H,5-6H2,1-4H3 |
| InChIKey | DXAZCDQDCNQCTJ-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 207.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.48 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|