C22H27ClO9 — CID 162956051
[(1S,2S,6R,7R,9R,10S,11S,12R,14S)-9-(chloromethyl)-9,11-dihydroxy-14-methyl-5-methylidene-4-oxo-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradecan-7-yl] 4-acetyloxy-2-methylbut-2-enoate (PubChem CID 162956051) has the molecular formula C22H27ClO9 and a molecular weight of 470.90 g/mol. Its IUPAC name is [(1S,2S,6R,7R,9R,10S,11S,12R,14S)-9-(chloromethyl)-9,11-dihydroxy-14-methyl-5-methylidene-4-oxo-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradecan-7-yl] 4-acetyloxy-2-methylbut-2-enoate.
| Compound Name | [(1S,2S,6R,7R,9R,10S,11S,12R,14S)-9-(chloromethyl)-9,11-dihydroxy-14-methyl-5-methylidene-4-oxo-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradecan-7-yl] 4-acetyloxy-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162956051 |
| Molecular Formula | C22H27ClO9 |
| Molecular Weight | 470.90 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | [(1S,2S,6R,7R,9R,10S,11S,12R,14S)-9-(chloromethyl)-9,11-dihydroxy-14-methyl-5-methylidene-4-oxo-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradecan-7-yl] 4-acetyloxy-2-methylbut-2-enoate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1[C@H](OC(=O)C(C)=CCOC(C)=O)C[C@](O)(CCl)[C@@H]1[C@H](O)[C@H]3O[C@@]3(C)[C@H]21 |
| InChI | InChI=1S/C22H27ClO9/c1-9(5-6-29-11(3)24)19(26)30-12-7-22(28,8-23)14-15(21(4)18(32-21)16(14)25)17-13(12)10(2)20(27)31-17/h5,12-18,25,28H,2,6-8H2,1,3-4H3/t12-,13-,14+,15+,16+,17+,18-,21+,22+/m1/s1 |
| InChIKey | UYIUZKCMTKDYRT-MNDBSHCESA-N |
| XLogP | 0.64 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.90 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|