C19H23ClO7 — CID 50990197
[(3aR,4S,6aR,7R,8S,9S,9bS)-9-(chloromethyl)-7,8,9-trihydroxy-3,6-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] 2-methylprop-2-enoate (PubChem CID 50990197) has the molecular formula C19H23ClO7 and a molecular weight of 398.84 g/mol. Its IUPAC name is [(3aR,4S,6aR,7R,8S,9S,9bS)-9-(chloromethyl)-7,8,9-trihydroxy-3,6-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] 2-methylprop-2-enoate.
| Compound Name | [(3aR,4S,6aR,7R,8S,9S,9bS)-9-(chloromethyl)-7,8,9-trihydroxy-3,6-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 50990197 |
| Molecular Formula | C19H23ClO7 |
| Molecular Weight | 398.84 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | [(3aR,4S,6aR,7R,8S,9S,9bS)-9-(chloromethyl)-7,8,9-trihydroxy-3,6-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O[C@H]1CC(=C)[C@H]2C([C@H]3OC(=O)C(=C)[C@H]13)C(O)(CCl)[C@@H](O)[C@@H]2O |
| InChI | InChI=1S/C19H23ClO7/c1-7(2)17(23)26-10-5-8(3)11-13(15-12(10)9(4)18(24)27-15)19(25,6-20)16(22)14(11)21/h10-16,21-22,25H,1,3-6H2,2H3/t10-,11-,12+,13?,14+,15-,16-,19?/m0/s1 |
| InChIKey | ADYLGDMJIHJMCB-XJZUOBEVSA-N |
| XLogP | 0.47 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.84 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|