C22H27ClO10 — CID 163027867
[8-acetyloxy-9-hydroxy-9-(hydroxymethyl)-3,6-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] 2-acetyloxy-3-chloropropanoate (PubChem CID 163027867) has the molecular formula C22H27ClO10 and a molecular weight of 486.90 g/mol. Its IUPAC name is [8-acetyloxy-9-hydroxy-9-(hydroxymethyl)-3,6-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] 2-acetyloxy-3-chloropropanoate.
| Compound Name | [8-acetyloxy-9-hydroxy-9-(hydroxymethyl)-3,6-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] 2-acetyloxy-3-chloropropanoate |
|---|---|
| PubChem CID | 163027867 |
| Molecular Formula | C22H27ClO10 |
| Molecular Weight | 486.90 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | [8-acetyloxy-9-hydroxy-9-(hydroxymethyl)-3,6-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] 2-acetyloxy-3-chloropropanoate |
| SMILES | C=C1CC(OC(=O)C(CCl)OC(C)=O)C2C(=C)C(=O)OC2C2C1CC(OC(C)=O)C2(O)CO |
| InChI | InChI=1S/C22H27ClO10/c1-9-5-14(32-21(28)15(7-23)30-11(3)25)17-10(2)20(27)33-19(17)18-13(9)6-16(31-12(4)26)22(18,29)8-24/h13-19,24,29H,1-2,5-8H2,3-4H3 |
| InChIKey | BJLVRCLCTBLIIL-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.90 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|