C21H27ClO9 — CID 163080272
[(3aS,4R,6aR,8R,9S,9aS,9bR)-8-acetyloxy-9-hydroxy-9-(hydroxymethyl)-3,6-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] (2R)-3-chloro-2-hydroxy-2-methylpropanoate (PubChem CID 163080272) has the molecular formula C21H27ClO9 and a molecular weight of 458.89 g/mol. Its IUPAC name is [(3aS,4R,6aR,8R,9S,9aS,9bR)-8-acetyloxy-9-hydroxy-9-(hydroxymethyl)-3,6-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] (2R)-3-chloro-2-hydroxy-2-methylpropanoate.
| Compound Name | [(3aS,4R,6aR,8R,9S,9aS,9bR)-8-acetyloxy-9-hydroxy-9-(hydroxymethyl)-3,6-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] (2R)-3-chloro-2-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 163080272 |
| Molecular Formula | C21H27ClO9 |
| Molecular Weight | 458.89 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | [(3aS,4R,6aR,8R,9S,9aS,9bR)-8-acetyloxy-9-hydroxy-9-(hydroxymethyl)-3,6-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] (2R)-3-chloro-2-hydroxy-2-methylpropanoate |
| SMILES | C=C1C(=O)O[C@@H]2[C@@H]1[C@H](OC(=O)[C@@](C)(O)CCl)CC(=C)[C@@H]1C[C@@H](OC(C)=O)[C@@](O)(CO)[C@H]21 |
| InChI | InChI=1S/C21H27ClO9/c1-9-5-13(30-19(26)20(4,27)7-22)15-10(2)18(25)31-17(15)16-12(9)6-14(29-11(3)24)21(16,28)8-23/h12-17,23,27-28H,1-2,5-8H2,3-4H3/t12-,13+,14+,15-,16-,17+,20-,21-/m0/s1 |
| InChIKey | BQZOLDKICRHJKZ-CKGYILMSSA-N |
| XLogP | 0.24 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.89 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|