C19H20Cl2O7 — CID 162934140
[8-chloro-6-(hydroxymethyl)-9-methyl-3-methylidene-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl] 3-chloro-2-hydroxy-2-methylpropanoate (PubChem CID 162934140) has the molecular formula C19H20Cl2O7 and a molecular weight of 431.27 g/mol. Its IUPAC name is [8-chloro-6-(hydroxymethyl)-9-methyl-3-methylidene-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl] 3-chloro-2-hydroxy-2-methylpropanoate.
| Compound Name | [8-chloro-6-(hydroxymethyl)-9-methyl-3-methylidene-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl] 3-chloro-2-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 162934140 |
| Molecular Formula | C19H20Cl2O7 |
| Molecular Weight | 431.27 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | [8-chloro-6-(hydroxymethyl)-9-methyl-3-methylidene-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl] 3-chloro-2-hydroxy-2-methylpropanoate |
| SMILES | C=C1C(=O)OC2C3C(C)=C(Cl)C(=O)C3=C(CO)CC(OC(=O)C(C)(O)CCl)C12 |
| InChI | InChI=1S/C19H20Cl2O7/c1-7-12-13(15(23)14(7)21)9(5-22)4-10(27-18(25)19(3,26)6-20)11-8(2)17(24)28-16(11)12/h10-12,16,22,26H,2,4-6H2,1,3H3 |
| InChIKey | YKUQOQMKFOWHQA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|