C21H27ClO9 — CID 23983717
[3-(acetyloxymethyl)-3,8-dihydroxy-6,9-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] 3-chloro-2-hydroxy-2-methylpropanoate (PubChem CID 23983717) has the molecular formula C21H27ClO9 and a molecular weight of 458.89 g/mol. Its IUPAC name is [3-(acetyloxymethyl)-3,8-dihydroxy-6,9-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] 3-chloro-2-hydroxy-2-methylpropanoate.
| Compound Name | [3-(acetyloxymethyl)-3,8-dihydroxy-6,9-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] 3-chloro-2-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 23983717 |
| Molecular Formula | C21H27ClO9 |
| Molecular Weight | 458.89 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | [3-(acetyloxymethyl)-3,8-dihydroxy-6,9-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] 3-chloro-2-hydroxy-2-methylpropanoate |
| SMILES | C=C1CC(OC(=O)C(C)(O)CCl)C2C(OC(=O)C2(O)COC(C)=O)C2C(=C)C(O)CC12 |
| InChI | InChI=1S/C21H27ClO9/c1-9-5-14(30-18(25)20(4,27)7-22)16-17(15-10(2)13(24)6-12(9)15)31-19(26)21(16,28)8-29-11(3)23/h12-17,24,27-28H,1-2,5-8H2,3-4H3 |
| InChIKey | HXLKSDHARGZRCZ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.89 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|