C29H29ClO7 — CID 122648043
[4-benzoyloxy-3-(chloromethyl)-3-hydroxy-9-methyl-6-methylidene-2-oxo-4,5,6a,7,8,9,9a,9b-octahydro-3aH-azuleno[4,5-b]furan-8-yl] benzoate (PubChem CID 122648043) has the molecular formula C29H29ClO7 and a molecular weight of 525.00 g/mol. Its IUPAC name is [4-benzoyloxy-3-(chloromethyl)-3-hydroxy-9-methyl-6-methylidene-2-oxo-4,5,6a,7,8,9,9a,9b-octahydro-3aH-azuleno[4,5-b]furan-8-yl] benzoate.
| Compound Name | [4-benzoyloxy-3-(chloromethyl)-3-hydroxy-9-methyl-6-methylidene-2-oxo-4,5,6a,7,8,9,9a,9b-octahydro-3aH-azuleno[4,5-b]furan-8-yl] benzoate |
|---|---|
| PubChem CID | 122648043 |
| Molecular Formula | C29H29ClO7 |
| Molecular Weight | 525.00 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | [4-benzoyloxy-3-(chloromethyl)-3-hydroxy-9-methyl-6-methylidene-2-oxo-4,5,6a,7,8,9,9a,9b-octahydro-3aH-azuleno[4,5-b]furan-8-yl] benzoate |
| SMILES | C=C1CC(OC(=O)c2ccccc2)C2C(OC(=O)C2(O)CCl)C2C1CC(OC(=O)c1ccccc1)C2C |
| InChI | InChI=1S/C29H29ClO7/c1-16-13-22(36-27(32)19-11-7-4-8-12-19)24-25(37-28(33)29(24,34)15-30)23-17(2)21(14-20(16)23)35-26(31)18-9-5-3-6-10-18/h3-12,17,20-25,34H,1,13-15H2,2H3 |
| InChIKey | STEKTDRQQCLNMS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.00 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|