C14H13BrO5 — CID 70020507
[(1R,3R,4S,5R)-3-bromo-1-hydroxy-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl] benzoate (PubChem CID 70020507) has the molecular formula C14H13BrO5 and a molecular weight of 341.16 g/mol. Its IUPAC name is [(1R,3R,4S,5R)-3-bromo-1-hydroxy-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl] benzoate.
| Compound Name | [(1R,3R,4S,5R)-3-bromo-1-hydroxy-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl] benzoate |
|---|---|
| PubChem CID | 70020507 |
| Molecular Formula | C14H13BrO5 |
| Molecular Weight | 341.16 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | [(1R,3R,4S,5R)-3-bromo-1-hydroxy-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl] benzoate |
| SMILES | O=C(O[C@@H]1[C@H](Br)C[C@]2(O)C[C@H]1OC2=O)c1ccccc1 |
| InChI | InChI=1S/C14H13BrO5/c15-9-6-14(18)7-10(19-13(14)17)11(9)20-12(16)8-4-2-1-3-5-8/h1-5,9-11,18H,6-7H2/t9-,10-,11-,14+/m1/s1 |
| InChIKey | XXZUFZHOWAVZLD-BIAAXOCRSA-N |
| XLogP | 1.43 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.16 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|