C21H29ClO8 — CID 163067973
[(3aR,4S,6aR,8R,9S,9aS,9bS)-9-(chloromethyl)-8,9-dihydroxy-3,6-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] (2R)-2-ethoxy-3-hydroxy-2-methylpropanoate (PubChem CID 163067973) has the molecular formula C21H29ClO8 and a molecular weight of 444.91 g/mol. Its IUPAC name is [(3aR,4S,6aR,8R,9S,9aS,9bS)-9-(chloromethyl)-8,9-dihydroxy-3,6-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] (2R)-2-ethoxy-3-hydroxy-2-methylpropanoate.
| Compound Name | [(3aR,4S,6aR,8R,9S,9aS,9bS)-9-(chloromethyl)-8,9-dihydroxy-3,6-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] (2R)-2-ethoxy-3-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 163067973 |
| Molecular Formula | C21H29ClO8 |
| Molecular Weight | 444.91 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | [(3aR,4S,6aR,8R,9S,9aS,9bS)-9-(chloromethyl)-8,9-dihydroxy-3,6-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] (2R)-2-ethoxy-3-hydroxy-2-methylpropanoate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1[C@@H](OC(=O)[C@@](C)(CO)OCC)CC(=C)[C@@H]1C[C@@H](O)[C@](O)(CCl)[C@H]21 |
| InChI | InChI=1S/C21H29ClO8/c1-5-28-20(4,9-23)19(26)29-13-6-10(2)12-7-14(24)21(27,8-22)16(12)17-15(13)11(3)18(25)30-17/h12-17,23-24,27H,2-3,5-9H2,1,4H3/t12-,13-,14+,15+,16-,17-,20+,21+/m0/s1 |
| InChIKey | BKGOOGOAAWZTIY-UFLRYIATSA-N |
| XLogP | 0.71 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.91 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|