C21H28O9 — CID 162957141
(1S,3aS,5S,5aS,9aR)-1,5-dimethyl-8-[[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-1,3a,4,5,5a,9a-hexahydroazuleno[6,5-b]furan-2,6-dione (PubChem CID 162957141) has the molecular formula C21H28O9 and a molecular weight of 424.45 g/mol. Its IUPAC name is (1S,3aS,5S,5aS,9aR)-1,5-dimethyl-8-[[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-1,3a,4,5,5a,9a-hexahydroazuleno[6,5-b]furan-2,6-dione.
| Compound Name | (1S,3aS,5S,5aS,9aR)-1,5-dimethyl-8-[[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-1,3a,4,5,5a,9a-hexahydroazuleno[6,5-b]furan-2,6-dione |
|---|---|
| PubChem CID | 162957141 |
| Molecular Formula | C21H28O9 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | (1S,3aS,5S,5aS,9aR)-1,5-dimethyl-8-[[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-1,3a,4,5,5a,9a-hexahydroazuleno[6,5-b]furan-2,6-dione |
| SMILES | C[C@@H]1C(=O)O[C@H]2C[C@H](C)[C@@H]3C(=O)C=C(CO[C@@H]4O[C@H](CO)[C@@H](O)[C@@H](O)[C@H]4O)C3=C[C@@H]21 |
| InChI | InChI=1S/C21H28O9/c1-8-3-14-11(9(2)20(27)29-14)5-12-10(4-13(23)16(8)12)7-28-21-19(26)18(25)17(24)15(6-22)30-21/h4-5,8-9,11,14-19,21-22,24-26H,3,6-7H2,1-2H3/t8-,9-,11+,14-,15+,16-,17+,18+,19+,21+/m0/s1 |
| InChIKey | NNOWTYCMYNTBTA-ZFDGUZEPSA-N |
| XLogP | -0.93 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |