C21H34O9 — CID 163193070
(3S,3aR,7S,8aR)-6-[(1R,3S)-3-hydroxy-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-3,7-dimethyl-3,3a,4,7,8,8a-hexahydrocyclohepta[b]furan-2-one (PubChem CID 163193070) has the molecular formula C21H34O9 and a molecular weight of 430.49 g/mol. Its IUPAC name is (3S,3aR,7S,8aR)-6-[(1R,3S)-3-hydroxy-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-3,7-dimethyl-3,3a,4,7,8,8a-hexahydrocyclohepta[b]furan-2-one.
| Compound Name | (3S,3aR,7S,8aR)-6-[(1R,3S)-3-hydroxy-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-3,7-dimethyl-3,3a,4,7,8,8a-hexahydrocyclohepta[b]furan-2-one |
|---|---|
| PubChem CID | 163193070 |
| Molecular Formula | C21H34O9 |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | (3S,3aR,7S,8aR)-6-[(1R,3S)-3-hydroxy-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-3,7-dimethyl-3,3a,4,7,8,8a-hexahydrocyclohepta[b]furan-2-one |
| SMILES | C[C@H](O)C[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C1=CC[C@@H]2[C@H](C)C(=O)O[C@@H]2C[C@@H]1C |
| InChI | InChI=1S/C21H34O9/c1-9-6-14-13(11(3)20(27)28-14)5-4-12(9)15(7-10(2)23)29-21-19(26)18(25)17(24)16(8-22)30-21/h4,9-11,13-19,21-26H,5-8H2,1-3H3/t9-,10-,11-,13+,14+,15+,16+,17+,18-,19+,21+/m0/s1 |
| InChIKey | NVLSWZADLQKBJW-ZOZBTOCFSA-N |
| XLogP | -0.52 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|