C19H24O5 — CID 162958238
5,7-dihydroxy-8-[(2R)-2-methylbutanoyl]-4-pentylchromen-2-one (PubChem CID 162958238) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is 5,7-dihydroxy-8-[(2R)-2-methylbutanoyl]-4-pentylchromen-2-one.
| Compound Name | 5,7-dihydroxy-8-[(2R)-2-methylbutanoyl]-4-pentylchromen-2-one |
|---|---|
| PubChem CID | 162958238 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 5,7-dihydroxy-8-[(2R)-2-methylbutanoyl]-4-pentylchromen-2-one |
| SMILES | CCCCCc1cc(=O)oc2c(C(=O)[C@H](C)CC)c(O)cc(O)c12 |
| InChI | InChI=1S/C19H24O5/c1-4-6-7-8-12-9-15(22)24-19-16(12)13(20)10-14(21)17(19)18(23)11(3)5-2/h9-11,20-21H,4-8H2,1-3H3/t11-/m1/s1 |
| InChIKey | DCXAKCWKFHIXOT-LLVKDONJSA-N |
| XLogP | 4.17 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|