C20H30O2 — CID 162959004
(1S,4S,6R,9Z,11S,12R)-4,9,12-trimethyl-12-(4-methylpent-3-enyl)-5-oxatricyclo[9.1.0.04,6]dodec-9-en-8-one (PubChem CID 162959004) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (1S,4S,6R,9Z,11S,12R)-4,9,12-trimethyl-12-(4-methylpent-3-enyl)-5-oxatricyclo[9.1.0.04,6]dodec-9-en-8-one.
| Compound Name | (1S,4S,6R,9Z,11S,12R)-4,9,12-trimethyl-12-(4-methylpent-3-enyl)-5-oxatricyclo[9.1.0.04,6]dodec-9-en-8-one |
|---|---|
| PubChem CID | 162959004 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (1S,4S,6R,9Z,11S,12R)-4,9,12-trimethyl-12-(4-methylpent-3-enyl)-5-oxatricyclo[9.1.0.04,6]dodec-9-en-8-one |
| SMILES | CC(C)=CCC[C@@]1(C)[C@H]2/C=C(/C)C(=O)C[C@H]3O[C@@]3(C)CC[C@@H]21 |
| InChI | InChI=1S/C20H30O2/c1-13(2)7-6-9-19(4)15-8-10-20(5)18(22-20)12-17(21)14(3)11-16(15)19/h7,11,15-16,18H,6,8-10,12H2,1-5H3/b14-11-/t15-,16-,18+,19+,20-/m0/s1 |
| InChIKey | KZKCIAUBLOUTEW-BFMIXLMOSA-N |
| XLogP | 4.84 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|