C21H28O7 — CID 162960069
[(1R,2S,4S,6R,8R,9R)-6,9-diacetyloxy-3,3-dimethyl-7-methylidene-10-oxatricyclo[6.4.0.02,4]dodec-11-en-12-yl]methyl acetate (PubChem CID 162960069) has the molecular formula C21H28O7 and a molecular weight of 392.45 g/mol. Its IUPAC name is [(1R,2S,4S,6R,8R,9R)-6,9-diacetyloxy-3,3-dimethyl-7-methylidene-10-oxatricyclo[6.4.0.02,4]dodec-11-en-12-yl]methyl acetate.
| Compound Name | [(1R,2S,4S,6R,8R,9R)-6,9-diacetyloxy-3,3-dimethyl-7-methylidene-10-oxatricyclo[6.4.0.02,4]dodec-11-en-12-yl]methyl acetate |
|---|---|
| PubChem CID | 162960069 |
| Molecular Formula | C21H28O7 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | [(1R,2S,4S,6R,8R,9R)-6,9-diacetyloxy-3,3-dimethyl-7-methylidene-10-oxatricyclo[6.4.0.02,4]dodec-11-en-12-yl]methyl acetate |
| SMILES | C=C1[C@@H]2[C@@H](OC(C)=O)OC=C(COC(C)=O)[C@@H]2[C@@H]2[C@H](C[C@H]1OC(C)=O)C2(C)C |
| InChI | InChI=1S/C21H28O7/c1-10-16(27-12(3)23)7-15-19(21(15,5)6)18-14(8-25-11(2)22)9-26-20(17(10)18)28-13(4)24/h9,15-20H,1,7-8H2,2-6H3/t15-,16+,17-,18-,19-,20+/m0/s1 |
| InChIKey | SHMXJKCNUFGFSL-DWIKVQACSA-N |
| XLogP | 2.75 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|