C20H26O7 — CID 162947528
methyl 9-acetyloxy-12-(acetyloxymethyl)-3-methyl-7-methylidene-10-oxatricyclo[6.4.0.02,4]dodec-11-ene-3-carboxylate (PubChem CID 162947528) has the molecular formula C20H26O7 and a molecular weight of 378.42 g/mol. Its IUPAC name is methyl 9-acetyloxy-12-(acetyloxymethyl)-3-methyl-7-methylidene-10-oxatricyclo[6.4.0.02,4]dodec-11-ene-3-carboxylate.
| Compound Name | methyl 9-acetyloxy-12-(acetyloxymethyl)-3-methyl-7-methylidene-10-oxatricyclo[6.4.0.02,4]dodec-11-ene-3-carboxylate |
|---|---|
| PubChem CID | 162947528 |
| Molecular Formula | C20H26O7 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | methyl 9-acetyloxy-12-(acetyloxymethyl)-3-methyl-7-methylidene-10-oxatricyclo[6.4.0.02,4]dodec-11-ene-3-carboxylate |
| SMILES | C=C1CCC2C(C3C(COC(C)=O)=COC(OC(C)=O)C13)C2(C)C(=O)OC |
| InChI | InChI=1S/C20H26O7/c1-10-6-7-14-17(20(14,4)19(23)24-5)16-13(8-25-11(2)21)9-26-18(15(10)16)27-12(3)22/h9,14-18H,1,6-8H2,2-5H3 |
| InChIKey | WGGIEUHNKMVGPD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|