C33H46O9 — CID 162937659
[9-acetyloxy-12-(acetyloxymethyl)-3-(hydroxymethyl)spiro[10-oxatricyclo[6.4.0.02,4]dodec-11-ene-7,2'-oxirane]-3-yl]methyl tetradeca-2,4,8-trienoate (PubChem CID 162937659) has the molecular formula C33H46O9 and a molecular weight of 586.72 g/mol. Its IUPAC name is [9-acetyloxy-12-(acetyloxymethyl)-3-(hydroxymethyl)spiro[10-oxatricyclo[6.4.0.02,4]dodec-11-ene-7,2'-oxirane]-3-yl]methyl tetradeca-2,4,8-trienoate.
| Compound Name | [9-acetyloxy-12-(acetyloxymethyl)-3-(hydroxymethyl)spiro[10-oxatricyclo[6.4.0.02,4]dodec-11-ene-7,2'-oxirane]-3-yl]methyl tetradeca-2,4,8-trienoate |
|---|---|
| PubChem CID | 162937659 |
| Molecular Formula | C33H46O9 |
| Molecular Weight | 586.72 g/mol |
| Exact Mass | 586.31 |
| IUPAC Name | [9-acetyloxy-12-(acetyloxymethyl)-3-(hydroxymethyl)spiro[10-oxatricyclo[6.4.0.02,4]dodec-11-ene-7,2'-oxirane]-3-yl]methyl tetradeca-2,4,8-trienoate |
| SMILES | CCCCCC=CCCC=CC=CC(=O)OCC1(CO)C2CCC3(CO3)C3C(OC(C)=O)OC=C(COC(C)=O)C3C21 |
| InChI | InChI=1S/C33H46O9/c1-4-5-6-7-8-9-10-11-12-13-14-15-27(37)40-21-32(20-34)26-16-17-33(22-41-33)30-28(29(26)32)25(18-38-23(2)35)19-39-31(30)42-24(3)36/h8-9,12-15,19,26,28-31,34H,4-7,10-11,16-18,20-22H2,1-3H3 |
| InChIKey | CZVGOOFLFOGCTP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 120.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.72 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|