C28H38O10 — CID 163109164
[(5S)-5-acetyloxy-2-(acetyloxymethyl)-5-[(1S,4S,6R,10R,11R)-11-acetyloxy-4-methyl-9-methylidene-5,12-dioxatricyclo[8.4.0.04,6]tetradec-13-en-14-yl]pent-2-enyl] acetate (PubChem CID 163109164) has the molecular formula C28H38O10 and a molecular weight of 534.60 g/mol. Its IUPAC name is [(5S)-5-acetyloxy-2-(acetyloxymethyl)-5-[(1S,4S,6R,10R,11R)-11-acetyloxy-4-methyl-9-methylidene-5,12-dioxatricyclo[8.4.0.04,6]tetradec-13-en-14-yl]pent-2-enyl] acetate.
| Compound Name | [(5S)-5-acetyloxy-2-(acetyloxymethyl)-5-[(1S,4S,6R,10R,11R)-11-acetyloxy-4-methyl-9-methylidene-5,12-dioxatricyclo[8.4.0.04,6]tetradec-13-en-14-yl]pent-2-enyl] acetate |
|---|---|
| PubChem CID | 163109164 |
| Molecular Formula | C28H38O10 |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | [(5S)-5-acetyloxy-2-(acetyloxymethyl)-5-[(1S,4S,6R,10R,11R)-11-acetyloxy-4-methyl-9-methylidene-5,12-dioxatricyclo[8.4.0.04,6]tetradec-13-en-14-yl]pent-2-enyl] acetate |
| SMILES | C=C1CC[C@H]2O[C@@]2(C)CC[C@@H]2C([C@H](CC=C(COC(C)=O)COC(C)=O)OC(C)=O)=CO[C@H](OC(C)=O)[C@@H]12 |
| InChI | InChI=1S/C28H38O10/c1-16-7-10-25-28(6,38-25)12-11-22-23(15-35-27(26(16)22)37-20(5)32)24(36-19(4)31)9-8-21(13-33-17(2)29)14-34-18(3)30/h8,15,22,24-27H,1,7,9-14H2,2-6H3/t22-,24+,25-,26+,27-,28+/m1/s1 |
| InChIKey | GWWFQCVDLTVHBV-YBQKAXOLSA-N |
| XLogP | 3.68 |
| TPSA | 126.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|