C26H36O8 — CID 22832328
[(E)-5-[(1R,4aS,7E,10R,11aR)-1-acetyloxy-10-hydroxy-7-methyl-11-methylidene-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-4-yl]-5-acetyloxy-2-methylpent-2-enyl] acetate (PubChem CID 22832328) has the molecular formula C26H36O8 and a molecular weight of 476.57 g/mol. Its IUPAC name is [(E)-5-[(1R,4aS,7E,10R,11aR)-1-acetyloxy-10-hydroxy-7-methyl-11-methylidene-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-4-yl]-5-acetyloxy-2-methylpent-2-enyl] acetate.
| Compound Name | [(E)-5-[(1R,4aS,7E,10R,11aR)-1-acetyloxy-10-hydroxy-7-methyl-11-methylidene-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-4-yl]-5-acetyloxy-2-methylpent-2-enyl] acetate |
|---|---|
| PubChem CID | 22832328 |
| Molecular Formula | C26H36O8 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | [(E)-5-[(1R,4aS,7E,10R,11aR)-1-acetyloxy-10-hydroxy-7-methyl-11-methylidene-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-4-yl]-5-acetyloxy-2-methylpent-2-enyl] acetate |
| SMILES | C=C1[C@@H]2[C@@H](OC(C)=O)OC=C(C(C/C=C(\C)COC(C)=O)OC(C)=O)[C@H]2CC/C(C)=C/C[C@H]1O |
| InChI | InChI=1S/C26H36O8/c1-15-7-10-21-22(24(33-19(5)28)12-9-16(2)13-31-18(4)27)14-32-26(34-20(6)29)25(21)17(3)23(30)11-8-15/h8-9,14,21,23-26,30H,3,7,10-13H2,1-2,4-6H3/b15-8+,16-9+/t21-,23-,24?,25+,26-/m1/s1 |
| InChIKey | HZPBMZKVJYTDIC-PHZHZCEMSA-N |
| XLogP | 3.90 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|