C23H34O4 — CID 74052489
[3-methoxy-7-methyl-11-methylidene-4-(4-methylpent-3-enylidene)-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-1-yl] acetate (PubChem CID 74052489) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is [3-methoxy-7-methyl-11-methylidene-4-(4-methylpent-3-enylidene)-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-1-yl] acetate.
| Compound Name | [3-methoxy-7-methyl-11-methylidene-4-(4-methylpent-3-enylidene)-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-1-yl] acetate |
|---|---|
| PubChem CID | 74052489 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | [3-methoxy-7-methyl-11-methylidene-4-(4-methylpent-3-enylidene)-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-1-yl] acetate |
| SMILES | C=C1CCC=C(C)CCC2C(=CCC=C(C)C)C(OC)OC(OC(C)=O)C12 |
| InChI | InChI=1S/C23H34O4/c1-15(2)9-7-12-20-19-14-13-16(3)10-8-11-17(4)21(19)23(26-18(5)24)27-22(20)25-6/h9-10,12,19,21-23H,4,7-8,11,13-14H2,1-3,5-6H3 |
| InChIKey | YWNFEGSZFPYUPC-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|