C29H43NO3 — CID 101422942
[(1S,4Z,9R,10R,11S)-11-formyl-4-methyl-8-methylidene-11-(4-methylpent-3-enyl)-10-bicyclo[7.2.0]undec-4-enyl] (Z)-3-piperidin-1-ylbut-2-enoate (PubChem CID 101422942) has the molecular formula C29H43NO3 and a molecular weight of 453.67 g/mol. Its IUPAC name is [(1S,4Z,9R,10R,11S)-11-formyl-4-methyl-8-methylidene-11-(4-methylpent-3-enyl)-10-bicyclo[7.2.0]undec-4-enyl] (Z)-3-piperidin-1-ylbut-2-enoate.
| Compound Name | [(1S,4Z,9R,10R,11S)-11-formyl-4-methyl-8-methylidene-11-(4-methylpent-3-enyl)-10-bicyclo[7.2.0]undec-4-enyl] (Z)-3-piperidin-1-ylbut-2-enoate |
|---|---|
| PubChem CID | 101422942 |
| Molecular Formula | C29H43NO3 |
| Molecular Weight | 453.67 g/mol |
| Exact Mass | 453.32 |
| IUPAC Name | [(1S,4Z,9R,10R,11S)-11-formyl-4-methyl-8-methylidene-11-(4-methylpent-3-enyl)-10-bicyclo[7.2.0]undec-4-enyl] (Z)-3-piperidin-1-ylbut-2-enoate |
| SMILES | C=C1CC/C=C(/C)CC[C@H]2[C@H]1[C@@H](OC(=O)/C=C(/C)N1CCCCC1)[C@]2(C=O)CCC=C(C)C |
| InChI | InChI=1S/C29H43NO3/c1-21(2)11-10-16-29(20-31)25-15-14-22(3)12-9-13-23(4)27(25)28(29)33-26(32)19-24(5)30-17-7-6-8-18-30/h11-12,19-20,25,27-28H,4,6-10,13-18H2,1-3,5H3/b22-12-,24-19-/t25-,27-,28+,29-/m0/s1 |
| InChIKey | DNVWLWCRYMRHFT-GJIZXTGHSA-N |
| XLogP | 6.54 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.67 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|