C22H30O5 — CID 162961729
[(3aR,5aS,7S,9aR,9bS,10S,11aS)-7-hydroxy-6,6,9a-trimethyl-1-methylidene-2-oxo-3a,5,5a,7,8,9,9b,10,11,11a-decahydronaphtho[1,2-g][1]benzofuran-10-yl] acetate (PubChem CID 162961729) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is [(3aR,5aS,7S,9aR,9bS,10S,11aS)-7-hydroxy-6,6,9a-trimethyl-1-methylidene-2-oxo-3a,5,5a,7,8,9,9b,10,11,11a-decahydronaphtho[1,2-g][1]benzofuran-10-yl] acetate.
| Compound Name | [(3aR,5aS,7S,9aR,9bS,10S,11aS)-7-hydroxy-6,6,9a-trimethyl-1-methylidene-2-oxo-3a,5,5a,7,8,9,9b,10,11,11a-decahydronaphtho[1,2-g][1]benzofuran-10-yl] acetate |
|---|---|
| PubChem CID | 162961729 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | [(3aR,5aS,7S,9aR,9bS,10S,11aS)-7-hydroxy-6,6,9a-trimethyl-1-methylidene-2-oxo-3a,5,5a,7,8,9,9b,10,11,11a-decahydronaphtho[1,2-g][1]benzofuran-10-yl] acetate |
| SMILES | C=C1C(=O)O[C@H]2C3=CC[C@@H]4C(C)(C)[C@@H](O)CC[C@@]4(C)[C@@H]3[C@@H](OC(C)=O)C[C@@H]12 |
| InChI | InChI=1S/C22H30O5/c1-11-14-10-15(26-12(2)23)18-13(19(14)27-20(11)25)6-7-16-21(3,4)17(24)8-9-22(16,18)5/h6,14-19,24H,1,7-10H2,2-5H3/t14-,15-,16+,17-,18-,19-,22+/m0/s1 |
| InChIKey | YWYUTUNHZMPPNO-QBKDGXDVSA-N |
| XLogP | 3.17 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|