C19H24O9 — CID 162961806
(4S)-6-methoxy-4,5-dimethyl-3-methylidene-8-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-isochromen-1-one (PubChem CID 162961806) has the molecular formula C19H24O9 and a molecular weight of 396.39 g/mol. Its IUPAC name is (4S)-6-methoxy-4,5-dimethyl-3-methylidene-8-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-isochromen-1-one.
| Compound Name | (4S)-6-methoxy-4,5-dimethyl-3-methylidene-8-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-isochromen-1-one |
|---|---|
| PubChem CID | 162961806 |
| Molecular Formula | C19H24O9 |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | (4S)-6-methoxy-4,5-dimethyl-3-methylidene-8-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-isochromen-1-one |
| SMILES | C=C1OC(=O)c2c(O[C@@H]3O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]3O)cc(OC)c(C)c2[C@@H]1C |
| InChI | InChI=1S/C19H24O9/c1-7-9(3)26-18(24)14-11(5-10(25-4)8(2)13(7)14)27-19-17(23)16(22)15(21)12(6-20)28-19/h5,7,12,15-17,19-23H,3,6H2,1-2,4H3/t7-,12+,15+,16-,17+,19-/m1/s1 |
| InChIKey | KLHPROQIMDYZHD-DKABUQCUSA-N |
| XLogP | -0.03 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |