C15H20O2 — CID 162963185
(2'S,3aR,5S,7aR)-2'-methyl-3,6-dimethylidenespiro[3a,4,7,7a-tetrahydro-1-benzofuran-5,1'-cyclopentane]-2-one (PubChem CID 162963185) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (2'S,3aR,5S,7aR)-2'-methyl-3,6-dimethylidenespiro[3a,4,7,7a-tetrahydro-1-benzofuran-5,1'-cyclopentane]-2-one.
| Compound Name | (2'S,3aR,5S,7aR)-2'-methyl-3,6-dimethylidenespiro[3a,4,7,7a-tetrahydro-1-benzofuran-5,1'-cyclopentane]-2-one |
|---|---|
| PubChem CID | 162963185 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (2'S,3aR,5S,7aR)-2'-methyl-3,6-dimethylidenespiro[3a,4,7,7a-tetrahydro-1-benzofuran-5,1'-cyclopentane]-2-one |
| SMILES | C=C1C(=O)O[C@@H]2CC(=C)[C@@]3(CCC[C@@H]3C)C[C@H]12 |
| InChI | InChI=1S/C15H20O2/c1-9-5-4-6-15(9)8-12-11(3)14(16)17-13(12)7-10(15)2/h9,12-13H,2-8H2,1H3/t9-,12+,13+,15-/m0/s1 |
| InChIKey | YWGQGEZTRMMMBF-FWHFQCOYSA-N |
| XLogP | 3.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|